C20H26F3N5O5S2 — CID 46883046
(4R)-3-[2-[amino-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]amino]acetyl]-1,3-thiazolidine-4-carbonitrile;2,2,2-trifluoroacetic acid (PubChem CID 46883046) has the molecular formula C20H26F3N5O5S2 and a molecular weight of 537.59 g/mol. Its IUPAC name is (4R)-3-[2-[amino-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]amino]acetyl]-1,3-thiazolidine-4-carbonitrile;2,2,2-trifluoroacetic acid.
| Compound Name | (4R)-3-[2-[amino-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]amino]acetyl]-1,3-thiazolidine-4-carbonitrile;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46883046 |
| Molecular Formula | C20H26F3N5O5S2 |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | (4R)-3-[2-[amino-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]amino]acetyl]-1,3-thiazolidine-4-carbonitrile;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(N(N)CC(=O)N3CSC[C@H]3C#N)CC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25N5O3S2.C2HF3O2/c1-14-2-4-17(5-3-14)28(25,26)21-8-6-15(7-9-21)23(20)11-18(24)22-13-27-12-16(22)10-19;3-2(4,5)1(6)7/h2-5,15-16H,6-9,11-13,20H2,1H3;(H,6,7)/t16-;/m1./s1 |
| InChIKey | SEXGAQMXFSGJIP-PKLMIRHRSA-N |
| XLogP | 1.38 |
| TPSA | 148.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|