C18H24ClN5O3S — CID 10174907
1-[2-[amino-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]amino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 10174907) has the molecular formula C18H24ClN5O3S and a molecular weight of 425.94 g/mol. Its IUPAC name is 1-[2-[amino-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]amino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | 1-[2-[amino-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 10174907 |
| Molecular Formula | C18H24ClN5O3S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 1-[2-[amino-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]amino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | N#CC1CCCN1C(=O)CN(N)C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H24ClN5O3S/c19-14-3-5-17(6-4-14)28(26,27)22-10-7-15(8-11-22)24(21)13-18(25)23-9-1-2-16(23)12-20/h3-6,15-16H,1-2,7-11,13,21H2 |
| InChIKey | CLDIKXKQJVMSJO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|