C22H30N6O5S — CID 68687161
N-[4-[4-[3-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]propanoyl]piperazin-1-yl]sulfonylphenyl]acetamide (PubChem CID 68687161) has the molecular formula C22H30N6O5S and a molecular weight of 490.59 g/mol. Its IUPAC name is N-[4-[4-[3-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]propanoyl]piperazin-1-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[4-[3-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]propanoyl]piperazin-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 68687161 |
| Molecular Formula | C22H30N6O5S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | N-[4-[4-[3-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]propanoyl]piperazin-1-yl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCN(C(=O)CCNCC(=O)N3CCCC3C#N)CC2)cc1 |
| InChI | InChI=1S/C22H30N6O5S/c1-17(29)25-18-4-6-20(7-5-18)34(32,33)27-13-11-26(12-14-27)21(30)8-9-24-16-22(31)28-10-2-3-19(28)15-23/h4-7,19,24H,2-3,8-14,16H2,1H3,(H,25,29) |
| InChIKey | KEJZQAMISBJAEB-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 142.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|