C20H26F3N5O5S2 — CID 87903217
N-amino-N-[2-[4-cyano-2-(2,2,2-trifluoroacetyl)oxy-1,3-thiazolidin-3-yl]ethyl]-1-(3-methylphenyl)sulfonylpiperidin-4-amine oxide (PubChem CID 87903217) has the molecular formula C20H26F3N5O5S2 and a molecular weight of 537.59 g/mol. Its IUPAC name is N-amino-N-[2-[4-cyano-2-(2,2,2-trifluoroacetyl)oxy-1,3-thiazolidin-3-yl]ethyl]-1-(3-methylphenyl)sulfonylpiperidin-4-amine oxide.
| Compound Name | N-amino-N-[2-[4-cyano-2-(2,2,2-trifluoroacetyl)oxy-1,3-thiazolidin-3-yl]ethyl]-1-(3-methylphenyl)sulfonylpiperidin-4-amine oxide |
|---|---|
| PubChem CID | 87903217 |
| Molecular Formula | C20H26F3N5O5S2 |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | N-amino-N-[2-[4-cyano-2-(2,2,2-trifluoroacetyl)oxy-1,3-thiazolidin-3-yl]ethyl]-1-(3-methylphenyl)sulfonylpiperidin-4-amine oxide |
| SMILES | Cc1cccc(S(=O)(=O)N2CCC([N+](N)([O-])CCN3C(C#N)CSC3OC(=O)C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C20H26F3N5O5S2/c1-14-3-2-4-17(11-14)35(31,32)26-7-5-16(6-8-26)28(25,30)10-9-27-15(12-24)13-34-19(27)33-18(29)20(21,22)23/h2-4,11,15-16,19H,5-10,13,25H2,1H3 |
| InChIKey | LNXIXVJFMRSZBK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|