C20H20ClNO4 — CID 46883941
2-(1,3-benzodioxol-5-yl)-4-chloro-3-(ethoxymethyl)-7-methoxy-1,4-dihydroquinoline (PubChem CID 46883941) has the molecular formula C20H20ClNO4 and a molecular weight of 373.84 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4-chloro-3-(ethoxymethyl)-7-methoxy-1,4-dihydroquinoline.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4-chloro-3-(ethoxymethyl)-7-methoxy-1,4-dihydroquinoline |
|---|---|
| PubChem CID | 46883941 |
| Molecular Formula | C20H20ClNO4 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4-chloro-3-(ethoxymethyl)-7-methoxy-1,4-dihydroquinoline |
| SMILES | CCOCC1=C(c2ccc3c(c2)OCO3)Nc2cc(OC)ccc2C1Cl |
| InChI | InChI=1S/C20H20ClNO4/c1-3-24-10-15-19(21)14-6-5-13(23-2)9-16(14)22-20(15)12-4-7-17-18(8-12)26-11-25-17/h4-9,19,22H,3,10-11H2,1-2H3 |
| InChIKey | ZLHWMBMZRFDQIN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|