C20H15F2NO3 — CID 46884010
3-(2,3-difluorophenyl)-2-(naphthalene-2-carbonylamino)propanoic acid (PubChem CID 46884010) has the molecular formula C20H15F2NO3 and a molecular weight of 355.34 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-2-(naphthalene-2-carbonylamino)propanoic acid.
| Compound Name | 3-(2,3-difluorophenyl)-2-(naphthalene-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 46884010 |
| Molecular Formula | C20H15F2NO3 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 3-(2,3-difluorophenyl)-2-(naphthalene-2-carbonylamino)propanoic acid |
| SMILES | O=C(NC(Cc1cccc(F)c1F)C(=O)O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H15F2NO3/c21-16-7-3-6-14(18(16)22)11-17(20(25)26)23-19(24)15-9-8-12-4-1-2-5-13(12)10-15/h1-10,17H,11H2,(H,23,24)(H,25,26) |
| InChIKey | HHCGNWGXRNKCRI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |