C21H22ClNO3 — CID 46884647
benzyl 1-acetyl-2-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxylate (PubChem CID 46884647) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is benzyl 1-acetyl-2-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl 1-acetyl-2-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 46884647 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | benzyl 1-acetyl-2-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxylate |
| SMILES | CC(=O)N1CCCC1(Cc1ccc(Cl)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H22ClNO3/c1-16(24)23-13-5-12-21(23,14-17-8-10-19(22)11-9-17)20(25)26-15-18-6-3-2-4-7-18/h2-4,6-11H,5,12-15H2,1H3 |
| InChIKey | JFJYCQYCQYPTAV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |