C22H22N2O3 — CID 46884671
benzyl 1-acetyl-2-[(4-cyanophenyl)methyl]pyrrolidine-2-carboxylate (PubChem CID 46884671) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is benzyl 1-acetyl-2-[(4-cyanophenyl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl 1-acetyl-2-[(4-cyanophenyl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 46884671 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | benzyl 1-acetyl-2-[(4-cyanophenyl)methyl]pyrrolidine-2-carboxylate |
| SMILES | CC(=O)N1CCCC1(Cc1ccc(C#N)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H22N2O3/c1-17(25)24-13-5-12-22(24,14-18-8-10-19(15-23)11-9-18)21(26)27-16-20-6-3-2-4-7-20/h2-4,6-11H,5,12-14,16H2,1H3 |
| InChIKey | SSXLGUJQULCFLD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |