C21H29N5O3 — CID 46886248
N-(4-aminobutyl)-N-[2-[[(2S)-1-methoxypropan-2-yl]amino]pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide (PubChem CID 46886248) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-(4-aminobutyl)-N-[2-[[(2S)-1-methoxypropan-2-yl]amino]pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide.
| Compound Name | N-(4-aminobutyl)-N-[2-[[(2S)-1-methoxypropan-2-yl]amino]pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 46886248 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | N-(4-aminobutyl)-N-[2-[[(2S)-1-methoxypropan-2-yl]amino]pyrimidin-4-yl]-2,3-dihydro-1-benzofuran-5-carboxamide |
| SMILES | COC[C@H](C)Nc1nccc(N(CCCCN)C(=O)c2ccc3c(c2)CCO3)n1 |
| InChI | InChI=1S/C21H29N5O3/c1-15(14-28-2)24-21-23-10-7-19(25-21)26(11-4-3-9-22)20(27)17-5-6-18-16(13-17)8-12-29-18/h5-7,10,13,15H,3-4,8-9,11-12,14,22H2,1-2H3,(H,23,24,25)/t15-/m0/s1 |
| InChIKey | TVPCUURVTHKRSS-HNNXBMFYSA-N |
| XLogP | 2.24 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|