C23H22N4O2 — CID 46886478
N-ethyl-N-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]-1-benzofuran-5-carboxamide (PubChem CID 46886478) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-ethyl-N-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]-1-benzofuran-5-carboxamide.
| Compound Name | N-ethyl-N-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 46886478 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-ethyl-N-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]-1-benzofuran-5-carboxamide |
| SMILES | CCN(C(=O)c1ccc2occc2c1)c1ccnc(N[C@@H](C)c2ccccc2)n1 |
| InChI | InChI=1S/C23H22N4O2/c1-3-27(22(28)19-9-10-20-18(15-19)12-14-29-20)21-11-13-24-23(26-21)25-16(2)17-7-5-4-6-8-17/h4-16H,3H2,1-2H3,(H,24,25,26)/t16-/m0/s1 |
| InChIKey | FMOXPSYOXCNFQE-INIZCTEOSA-N |
| XLogP | 5.06 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |