C36H45N5O3 — CID 21047516
N-[[3-[[[2-(2-methoxyethylamino)pyrimidin-4-yl]amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047516) has the molecular formula C36H45N5O3 and a molecular weight of 595.79 g/mol. Its IUPAC name is N-[[3-[[[2-(2-methoxyethylamino)pyrimidin-4-yl]amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[[3-[[[2-(2-methoxyethylamino)pyrimidin-4-yl]amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047516 |
| Molecular Formula | C36H45N5O3 |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | N-[[3-[[[2-(2-methoxyethylamino)pyrimidin-4-yl]amino]methyl]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | COCCNc1nccc(NCc2cccc(CNC(=O)c3ccc(Cc4cc5c(cc4C)C(C)(C)CCC5(C)C)o3)c2)n1 |
| InChI | InChI=1S/C36H45N5O3/c1-24-18-29-30(36(4,5)14-13-35(29,2)3)21-27(24)20-28-10-11-31(44-28)33(42)40-23-26-9-7-8-25(19-26)22-39-32-12-15-37-34(41-32)38-16-17-43-6/h7-12,15,18-19,21H,13-14,16-17,20,22-23H2,1-6H3,(H,40,42)(H2,37,38,39,41) |
| InChIKey | RZIZVFSDAXOWLW-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|