C33H38N4O2 — CID 21045834
5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[[4-[(pyrimidin-2-ylamino)methyl]phenyl]methyl]furan-2-carboxamide (PubChem CID 21045834) has the molecular formula C33H38N4O2 and a molecular weight of 522.69 g/mol. Its IUPAC name is 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[[4-[(pyrimidin-2-ylamino)methyl]phenyl]methyl]furan-2-carboxamide.
| Compound Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[[4-[(pyrimidin-2-ylamino)methyl]phenyl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21045834 |
| Molecular Formula | C33H38N4O2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[[4-[(pyrimidin-2-ylamino)methyl]phenyl]methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NCc3ccc(CNc4ncccn4)cc3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C33H38N4O2/c1-22-17-27-28(33(4,5)14-13-32(27,2)3)19-25(22)18-26-11-12-29(39-26)30(38)36-20-23-7-9-24(10-8-23)21-37-31-34-15-6-16-35-31/h6-12,15-17,19H,13-14,18,20-21H2,1-5H3,(H,36,38)(H,34,35,37) |
| InChIKey | BWHICKVEBDPGMZ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |