C19H17BrO2 — CID 46886657
[3-(4-Bromophenyl)oxiran-2-yl]-(5,6,7,8-tetrahydronaphthalen-2-yl)methanone (PubChem CID 46886657) has the molecular formula C19H17BrO2 and a molecular weight of 357.20 g/mol. Its IUPAC name is [3-(4-bromophenyl)oxiran-2-yl]-(5,6,7,8-tetrahydronaphthalen-2-yl)methanone.
| Compound Name | [3-(4-Bromophenyl)oxiran-2-yl]-(5,6,7,8-tetrahydronaphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 46886657 |
| Molecular Formula | C19H17BrO2 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | [3-(4-bromophenyl)oxiran-2-yl]-(5,6,7,8-tetrahydronaphthalen-2-yl)methanone |
| SMILES | C1CCC2=C(C1)C=CC(=C2)C(=O)C3C(O3)C4=CC=C(C=C4)Br |
| InChI | InChI=1S/C19H17BrO2/c20-16-9-7-13(8-10-16)18-19(22-18)17(21)15-6-5-12-3-1-2-4-14(12)11-15/h5-11,18-19H,1-4H2 |
| InChIKey | CXBMNMQTHZSDRI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | 416 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|