C17H8BrCl2F3N2O2 — CID 46887136
4-bromo-2-(2,6-dichlorophenyl)-5-[(2,3,4-trifluorophenyl)methoxy]pyridazin-3-one (PubChem CID 46887136) has the molecular formula C17H8BrCl2F3N2O2 and a molecular weight of 480.07 g/mol. Its IUPAC name is 4-bromo-2-(2,6-dichlorophenyl)-5-[(2,3,4-trifluorophenyl)methoxy]pyridazin-3-one.
| Compound Name | 4-bromo-2-(2,6-dichlorophenyl)-5-[(2,3,4-trifluorophenyl)methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 46887136 |
| Molecular Formula | C17H8BrCl2F3N2O2 |
| Molecular Weight | 480.07 g/mol |
| Exact Mass | 477.91 |
| IUPAC Name | 4-bromo-2-(2,6-dichlorophenyl)-5-[(2,3,4-trifluorophenyl)methoxy]pyridazin-3-one |
| SMILES | O=c1c(Br)c(OCc2ccc(F)c(F)c2F)cnn1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H8BrCl2F3N2O2/c18-13-12(27-7-8-4-5-11(21)15(23)14(8)22)6-24-25(17(13)26)16-9(19)2-1-3-10(16)20/h1-6H,7H2 |
| InChIKey | NSQLVYPLKLORLD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.07 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|