C22H19F4N3O4S2 — CID 46888095
N-[3-(4-methoxyphenyl)propyl]-5-sulfamoyl-2-(2,3,5,6-tetrafluorophenyl)sulfanylpyridine-3-carboxamide (PubChem CID 46888095) has the molecular formula C22H19F4N3O4S2 and a molecular weight of 529.54 g/mol. Its IUPAC name is N-[3-(4-methoxyphenyl)propyl]-5-sulfamoyl-2-(2,3,5,6-tetrafluorophenyl)sulfanylpyridine-3-carboxamide.
| Compound Name | N-[3-(4-methoxyphenyl)propyl]-5-sulfamoyl-2-(2,3,5,6-tetrafluorophenyl)sulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46888095 |
| Molecular Formula | C22H19F4N3O4S2 |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | N-[3-(4-methoxyphenyl)propyl]-5-sulfamoyl-2-(2,3,5,6-tetrafluorophenyl)sulfanylpyridine-3-carboxamide |
| SMILES | COc1ccc(CCCNC(=O)c2cc(S(N)(=O)=O)cnc2Sc2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C22H19F4N3O4S2/c1-33-13-6-4-12(5-7-13)3-2-8-28-21(30)15-9-14(35(27,31)32)11-29-22(15)34-20-18(25)16(23)10-17(24)19(20)26/h4-7,9-11H,2-3,8H2,1H3,(H,28,30)(H2,27,31,32) |
| InChIKey | LQGBGIQOCRJGKR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|