C38H52N6O6 — CID 46888630
2-N,2-N,12-N,12-N-tetrakis(2-methoxyethyl)-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2,12-dicarboxamide (PubChem CID 46888630) has the molecular formula C38H52N6O6 and a molecular weight of 688.87 g/mol. Its IUPAC name is 2-N,2-N,12-N,12-N-tetrakis(2-methoxyethyl)-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2,12-dicarboxamide.
| Compound Name | 2-N,2-N,12-N,12-N-tetrakis(2-methoxyethyl)-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2,12-dicarboxamide |
|---|---|
| PubChem CID | 46888630 |
| Molecular Formula | C38H52N6O6 |
| Molecular Weight | 688.87 g/mol |
| Exact Mass | 688.39 |
| IUPAC Name | 2-N,2-N,12-N,12-N-tetrakis(2-methoxyethyl)-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2,12-dicarboxamide |
| SMILES | COCCN(CCOC)C(=O)c1cc2cc3nc(cc4[nH]c(cc5nc(cc1[nH]2)CC5(C)C)cc4C(=O)N(CCOC)CCOC)CC3(C)C |
| InChI | InChI=1S/C38H52N6O6/c1-37(2)23-27-19-31-30(36(46)44(11-15-49-7)12-16-50-8)18-26(40-31)22-34-38(3,4)24-28(42-34)20-32-29(17-25(39-32)21-33(37)41-27)35(45)43(9-13-47-5)10-14-48-6/h17-22,39-40H,9-16,23-24H2,1-8H3/b25-21-,26-22-,27-19-,28-20-,31-19-,32-20-,33-21-,34-22- |
| InChIKey | IAWMEPSYBZZULY-RHDSAATJSA-N |
| XLogP | 4.83 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |