C17H20N4S — CID 46889390
4-[5-(1-aminobutyl)-3-methyl-1-benzothiophen-2-yl]pyrimidin-2-amine (PubChem CID 46889390) has the molecular formula C17H20N4S and a molecular weight of 312.44 g/mol. Its IUPAC name is 4-[5-(1-aminobutyl)-3-methyl-1-benzothiophen-2-yl]pyrimidin-2-amine.
| Compound Name | 4-[5-(1-aminobutyl)-3-methyl-1-benzothiophen-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 46889390 |
| Molecular Formula | C17H20N4S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-[5-(1-aminobutyl)-3-methyl-1-benzothiophen-2-yl]pyrimidin-2-amine |
| SMILES | CCCC(N)c1ccc2sc(-c3ccnc(N)n3)c(C)c2c1 |
| InChI | InChI=1S/C17H20N4S/c1-3-4-13(18)11-5-6-15-12(9-11)10(2)16(22-15)14-7-8-20-17(19)21-14/h5-9,13H,3-4,18H2,1-2H3,(H2,19,20,21) |
| InChIKey | POPPTVCPKRFFPU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |