C15H21NO2 — CID 46889878
1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpiperidine (PubChem CID 46889878) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpiperidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpiperidine |
|---|---|
| PubChem CID | 46889878 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpiperidine |
| SMILES | CC1(C)CCCCN1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H21NO2/c1-15(2)7-3-4-8-16(15)10-12-5-6-13-14(9-12)18-11-17-13/h5-6,9H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | GPMQMLKRUGUSNE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |