C27H43NO3 — CID 4689000
3-[(dicyclohexylamino)methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 4689000) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is 3-[(dicyclohexylamino)methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | 3-[(dicyclohexylamino)methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 4689000 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | 3-[(dicyclohexylamino)methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CC1CCC=C2CC3OC(=O)C(CN(C4CCCCC4)C4CCCCC4)C3C(O)C21C |
| InChI | InChI=1S/C27H43NO3/c1-18-10-9-11-19-16-23-24(25(29)27(18,19)2)22(26(30)31-23)17-28(20-12-5-3-6-13-20)21-14-7-4-8-15-21/h11,18,20-25,29H,3-10,12-17H2,1-2H3 |
| InChIKey | YBHOUNAYHPIIIV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|