About N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide
N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide (PubChem CID 46891151) has the molecular formula C21H23ClN2O
and a molecular weight of 354.88 g/mol. Its IUPAC name is N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide.
Molecular Properties
| Compound Name | N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide |
| PubChem CID | 46891151 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide |
| SMILES | O=C(NCC1C[C@H]2CC[C@@H](C1)N2)c1ccccc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H23ClN2O/c22-16-5-3-4-15(12-16)19-6-1-2-7-20(19)21(25)23-13-14-10-17-8-9-18(11-14)24-17/h1-7,12,14,17-18,24H,8-11,13H2,(H,23,25)/t14?,17-,18+ |
| InChIKey | LAMLYPBPRQOOOH-DODVFSASSA-N |
| XLogP | 4.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide?
The IUPAC name of N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide (CID 46891151) is N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide.
What is the SMILES notation for N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide?
The canonical SMILES for N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide is O=C(NCC1C[C@H]2CC[C@@H](C1)N2)c1ccccc1-c1cccc(Cl)c1.
What is the InChIKey of N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide?
The InChIKey is LAMLYPBPRQOOOH-DODVFSASSA-N. The full InChI is InChI=1S/C21H23ClN2O/c22-16-5-3-4-15(12-16)19-6-1-2-7-20(19)21(25)23-13-14-10-17-8-9-18(11-14)24-17/h1-7,12,14,17-18,24H,8-11,13H2,(H,23,25)/t14?,17-,18+.
What are the key properties of N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide?
N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide has a molecular weight of 354.88 g/mol, XLogP of 4.27, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methyl]-2-(3-chlorophenyl)benzamide is sourced from PubChem (CID 46891151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).