C23H27N5O4 — CID 46891271
7-methoxy-4-morpholin-4-yl-N-(1-pyrimidin-2-ylpiperidin-4-yl)-1-benzofuran-2-carboxamide (PubChem CID 46891271) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 7-methoxy-4-morpholin-4-yl-N-(1-pyrimidin-2-ylpiperidin-4-yl)-1-benzofuran-2-carboxamide.
| Compound Name | 7-methoxy-4-morpholin-4-yl-N-(1-pyrimidin-2-ylpiperidin-4-yl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 46891271 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 7-methoxy-4-morpholin-4-yl-N-(1-pyrimidin-2-ylpiperidin-4-yl)-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc(N2CCOCC2)c2cc(C(=O)NC3CCN(c4ncccn4)CC3)oc12 |
| InChI | InChI=1S/C23H27N5O4/c1-30-19-4-3-18(27-11-13-31-14-12-27)17-15-20(32-21(17)19)22(29)26-16-5-9-28(10-6-16)23-24-7-2-8-25-23/h2-4,7-8,15-16H,5-6,9-14H2,1H3,(H,26,29) |
| InChIKey | YHRJFTFVILMZLD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|