C17H13N5 — CID 46894037
N,8-diphenyl-7H-purin-6-amine (PubChem CID 46894037) has the molecular formula C17H13N5 and a molecular weight of 287.33 g/mol. Its IUPAC name is N,8-diphenyl-7H-purin-6-amine.
| Compound Name | N,8-diphenyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 46894037 |
| Molecular Formula | C17H13N5 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N,8-diphenyl-7H-purin-6-amine |
| SMILES | c1ccc(Nc2ncnc3nc(-c4ccccc4)[nH]c23)cc1 |
| InChI | InChI=1S/C17H13N5/c1-3-7-12(8-4-1)15-21-14-16(18-11-19-17(14)22-15)20-13-9-5-2-6-10-13/h1-11H,(H2,18,19,20,21,22) |
| InChIKey | OKZNIBWRMMFNQY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |