C18H13N7S — CID 46895540
3-(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,5-diphenylpyrazole-4-carbonitrile (PubChem CID 46895540) has the molecular formula C18H13N7S and a molecular weight of 359.42 g/mol. Its IUPAC name is 3-(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,5-diphenylpyrazole-4-carbonitrile.
| Compound Name | 3-(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,5-diphenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 46895540 |
| Molecular Formula | C18H13N7S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 3-(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,5-diphenylpyrazole-4-carbonitrile |
| SMILES | N#Cc1c(-c2n[nH]c(=S)n2N)nn(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H13N7S/c19-11-14-15(17-21-22-18(26)24(17)20)23-25(13-9-5-2-6-10-13)16(14)12-7-3-1-4-8-12/h1-10H,20H2,(H,22,26) |
| InChIKey | KEJMPWAWFDQMDJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|