C8H9N5S — CID 10998218
4-amino-3-(4-aminophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 10998218) has the molecular formula C8H9N5S and a molecular weight of 207.26 g/mol. Its IUPAC name is 4-amino-3-(4-aminophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-(4-aminophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 10998218 |
| Molecular Formula | C8H9N5S |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 4-amino-3-(4-aminophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Nc1ccc(-c2n[nH]c(=S)n2N)cc1 |
| InChI | InChI=1S/C8H9N5S/c9-6-3-1-5(2-4-6)7-11-12-8(14)13(7)10/h1-4H,9-10H2,(H,12,14) |
| InChIKey | ZUVLNGBKPZVVNO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 85.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|