C4H4N6S2 — CID 65216106
4-amino-3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 65216106) has the molecular formula C4H4N6S2 and a molecular weight of 200.25 g/mol. Its IUPAC name is 4-amino-3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 65216106 |
| Molecular Formula | C4H4N6S2 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 4-amino-3-(thiadiazol-4-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Nn1c(-c2csnn2)n[nH]c1=S |
| InChI | InChI=1S/C4H4N6S2/c5-10-3(7-8-4(10)11)2-1-12-9-6-2/h1H,5H2,(H,8,11) |
| InChIKey | RZPHOSGLVFARDE-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|