C10H8N4S2 — CID 61406469
4-amino-3-(1-benzothiophen-2-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 61406469) has the molecular formula C10H8N4S2 and a molecular weight of 248.34 g/mol. Its IUPAC name is 4-amino-3-(1-benzothiophen-2-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-(1-benzothiophen-2-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 61406469 |
| Molecular Formula | C10H8N4S2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 4-amino-3-(1-benzothiophen-2-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Nn1c(-c2cc3ccccc3s2)n[nH]c1=S |
| InChI | InChI=1S/C10H8N4S2/c11-14-9(12-13-10(14)15)8-5-6-3-1-2-4-7(6)16-8/h1-5H,11H2,(H,13,15) |
| InChIKey | PPXVZDAEYNQXFM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|