C8H9N5OS — CID 105063706
4-amino-3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-thione (PubChem CID 105063706) has the molecular formula C8H9N5OS and a molecular weight of 223.26 g/mol. Its IUPAC name is 4-amino-3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 105063706 |
| Molecular Formula | C8H9N5OS |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 4-amino-3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cnccc1-c1n[nH]c(=S)n1N |
| InChI | InChI=1S/C8H9N5OS/c1-14-6-4-10-3-2-5(6)7-11-12-8(15)13(7)9/h2-4H,9H2,1H3,(H,12,15) |
| InChIKey | BNLFPJPAGBOWTL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|