C9H9BrN4OS — CID 59052418
4-amino-3-(2-bromo-4-methoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 59052418) has the molecular formula C9H9BrN4OS and a molecular weight of 301.17 g/mol. Its IUPAC name is 4-amino-3-(2-bromo-4-methoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-(2-bromo-4-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 59052418 |
| Molecular Formula | C9H9BrN4OS |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | 4-amino-3-(2-bromo-4-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(-c2n[nH]c(=S)n2N)c(Br)c1 |
| InChI | InChI=1S/C9H9BrN4OS/c1-15-5-2-3-6(7(10)4-5)8-12-13-9(16)14(8)11/h2-4H,11H2,1H3,(H,13,16) |
| InChIKey | MCYVCALRVVFSKL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 68.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|