C26H41NO4S — CID 46895992
O-[(1R)-1-[(1R,2S,4R,6R,7S,10S,11R,14S)-14-(methoxymethoxy)-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-6-yl]ethyl] N,N-dimethylcarbamothioate (PubChem CID 46895992) has the molecular formula C26H41NO4S and a molecular weight of 463.68 g/mol. Its IUPAC name is O-[(1R)-1-[(1R,2S,4R,6R,7S,10S,11R,14S)-14-(methoxymethoxy)-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-6-yl]ethyl] N,N-dimethylcarbamothioate.
| Compound Name | O-[(1R)-1-[(1R,2S,4R,6R,7S,10S,11R,14S)-14-(methoxymethoxy)-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-6-yl]ethyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 46895992 |
| Molecular Formula | C26H41NO4S |
| Molecular Weight | 463.68 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | O-[(1R)-1-[(1R,2S,4R,6R,7S,10S,11R,14S)-14-(methoxymethoxy)-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-6-yl]ethyl] N,N-dimethylcarbamothioate |
| SMILES | COCO[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@@]2(C)[C@H]3C[C@H]3O[C@]32[C@@H](C)OC(=S)N(C)C)C1 |
| InChI | InChI=1S/C26H41NO4S/c1-16(30-23(32)27(4)5)26-22(31-26)14-21-19-8-7-17-13-18(29-15-28-6)9-11-24(17,2)20(19)10-12-25(21,26)3/h7,16,18-22H,8-15H2,1-6H3/t16-,18+,19-,20+,21+,22-,24+,25+,26-/m1/s1 |
| InChIKey | YKNKUCNKWFJUPK-ZVCXSNFOSA-N |
| XLogP | 4.94 |
| TPSA | 43.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.68 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|