C27H40O2 — CID 102049487
(3S,8R,9S,10R,13S,14S)-3-(methoxymethoxy)-10,13-dimethyl-17-(4-methylpent-1-ynyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 102049487) has the molecular formula C27H40O2 and a molecular weight of 396.62 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S)-3-(methoxymethoxy)-10,13-dimethyl-17-(4-methylpent-1-ynyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,8R,9S,10R,13S,14S)-3-(methoxymethoxy)-10,13-dimethyl-17-(4-methylpent-1-ynyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 102049487 |
| Molecular Formula | C27H40O2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S)-3-(methoxymethoxy)-10,13-dimethyl-17-(4-methylpent-1-ynyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | COCO[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(C#CCC(C)C)=CC[C@@H]32)C1 |
| InChI | InChI=1S/C27H40O2/c1-19(2)7-6-8-20-10-12-24-23-11-9-21-17-22(29-18-28-5)13-15-27(21,4)25(23)14-16-26(20,24)3/h9-10,19,22-25H,7,11-18H2,1-5H3/t22-,23-,24-,25-,26+,27-/m0/s1 |
| InChIKey | AZAZKQJIFRJVAQ-VSWVZXEDSA-N |
| XLogP | 6.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|