C12H14O3 — CID 46896150
(3aS,5aR,8aR,8bR)-5a-methyl-1,3a,4,5,8a,8b-hexahydrocyclopenta[e][1]benzofuran-2,8-dione (PubChem CID 46896150) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (3aS,5aR,8aR,8bR)-5a-methyl-1,3a,4,5,8a,8b-hexahydrocyclopenta[e][1]benzofuran-2,8-dione.
| Compound Name | (3aS,5aR,8aR,8bR)-5a-methyl-1,3a,4,5,8a,8b-hexahydrocyclopenta[e][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 46896150 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (3aS,5aR,8aR,8bR)-5a-methyl-1,3a,4,5,8a,8b-hexahydrocyclopenta[e][1]benzofuran-2,8-dione |
| SMILES | C[C@@]12C=CC(=O)[C@@H]1[C@H]1CC(=O)O[C@H]1CC2 |
| InChI | InChI=1S/C12H14O3/c1-12-4-2-8(13)11(12)7-6-10(14)15-9(7)3-5-12/h2,4,7,9,11H,3,5-6H2,1H3/t7-,9-,11-,12-/m0/s1 |
| InChIKey | MAIFDZTVACEGFA-QZDOIJKTSA-N |
| XLogP | 1.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |