C20H15ClF3NNaO7P — CID 46897715
sodium [5-chloro-6-methyl-4-oxo-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyridin-2-yl]methyl hydrogen phosphate (PubChem CID 46897715) has the molecular formula C20H15ClF3NNaO7P and a molecular weight of 527.75 g/mol. Its IUPAC name is sodium [5-chloro-6-methyl-4-oxo-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyridin-2-yl]methyl hydrogen phosphate.
| Compound Name | sodium [5-chloro-6-methyl-4-oxo-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyridin-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 46897715 |
| Molecular Formula | C20H15ClF3NNaO7P |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.01 |
| IUPAC Name | sodium [5-chloro-6-methyl-4-oxo-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyridin-2-yl]methyl hydrogen phosphate |
| SMILES | Cc1[nH]c(COP(=O)([O-])O)c(-c2ccc(Oc3ccc(OC(F)(F)F)cc3)cc2)c(=O)c1Cl.[Na+] |
| InChI | InChI=1S/C20H16ClF3NO7P.Na/c1-11-18(21)19(26)17(16(25-11)10-30-33(27,28)29)12-2-4-13(5-3-12)31-14-6-8-15(9-7-14)32-20(22,23)24;/h2-9H,10H2,1H3,(H,25,26)(H2,27,28,29);/q;+1/p-1 |
| InChIKey | RZFZSZDVVPNHAP-UHFFFAOYSA-M |
| XLogP | 1.68 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|