C20H14ArClF3N2O4 — CID 161152145
argon;5-chloro-2-(hydroxyiminomethyl)-6-methyl-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyridin-4-one (PubChem CID 161152145) has the molecular formula C20H14ArClF3N2O4 and a molecular weight of 478.74 g/mol. Its IUPAC name is argon;5-chloro-2-(hydroxyiminomethyl)-6-methyl-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyridin-4-one.
| Compound Name | argon;5-chloro-2-(hydroxyiminomethyl)-6-methyl-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 161152145 |
| Molecular Formula | C20H14ArClF3N2O4 |
| Molecular Weight | 478.74 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | argon;5-chloro-2-(hydroxyiminomethyl)-6-methyl-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyridin-4-one |
| SMILES | Cc1[nH]c(C=NO)c(-c2ccc(Oc3ccc(OC(F)(F)F)cc3)cc2)c(=O)c1Cl.[Ar] |
| InChI | InChI=1S/C20H14ClF3N2O4.Ar/c1-11-18(21)19(27)17(16(26-11)10-25-28)12-2-4-13(5-3-12)29-14-6-8-15(9-7-14)30-20(22,23)24;/h2-10,28H,1H3,(H,26,27); |
| InChIKey | UOVAUORIHPDYSV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.74 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|