C27H54O4Si2 — CID 46900164
2-[(1R,2R,5R,6R,7R,8R,10R)-1,5-dimethyl-7,10-bis(triethylsilyloxy)-11-oxatricyclo[6.2.1.02,6]undecan-8-yl]propan-2-ol (PubChem CID 46900164) has the molecular formula C27H54O4Si2 and a molecular weight of 498.90 g/mol. Its IUPAC name is 2-[(1R,2R,5R,6R,7R,8R,10R)-1,5-dimethyl-7,10-bis(triethylsilyloxy)-11-oxatricyclo[6.2.1.02,6]undecan-8-yl]propan-2-ol.
| Compound Name | 2-[(1R,2R,5R,6R,7R,8R,10R)-1,5-dimethyl-7,10-bis(triethylsilyloxy)-11-oxatricyclo[6.2.1.02,6]undecan-8-yl]propan-2-ol |
|---|---|
| PubChem CID | 46900164 |
| Molecular Formula | C27H54O4Si2 |
| Molecular Weight | 498.90 g/mol |
| Exact Mass | 498.36 |
| IUPAC Name | 2-[(1R,2R,5R,6R,7R,8R,10R)-1,5-dimethyl-7,10-bis(triethylsilyloxy)-11-oxatricyclo[6.2.1.02,6]undecan-8-yl]propan-2-ol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H]2[C@H](C)CC[C@H]2[C@@]2(C)O[C@]1(C(C)(C)O)C[C@H]2O[Si](CC)(CC)CC |
| InChI | InChI=1S/C27H54O4Si2/c1-11-32(12-2,13-3)29-22-19-27(25(8,9)28)24(30-33(14-4,15-5)16-6)23-20(7)17-18-21(23)26(22,10)31-27/h20-24,28H,11-19H2,1-10H3/t20-,21-,22-,23-,24-,26-,27-/m1/s1 |
| InChIKey | SSSLMZFGPVPUCX-CJDAWWQKSA-N |
| XLogP | 7.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.90 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|