C27H54O3Si2 — CID 46900165
[(1R,2R,5R,6R,7R,8S,10R)-1,5-dimethyl-8-propan-2-yl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undecan-10-yl]oxy-triethylsilane (PubChem CID 46900165) has the molecular formula C27H54O3Si2 and a molecular weight of 482.90 g/mol. Its IUPAC name is [(1R,2R,5R,6R,7R,8S,10R)-1,5-dimethyl-8-propan-2-yl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undecan-10-yl]oxy-triethylsilane.
| Compound Name | [(1R,2R,5R,6R,7R,8S,10R)-1,5-dimethyl-8-propan-2-yl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undecan-10-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 46900165 |
| Molecular Formula | C27H54O3Si2 |
| Molecular Weight | 482.90 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | [(1R,2R,5R,6R,7R,8S,10R)-1,5-dimethyl-8-propan-2-yl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undecan-10-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H]2[C@H](C)CC[C@H]2[C@@]2(C)O[C@]1(C(C)C)C[C@H]2O[Si](CC)(CC)CC |
| InChI | InChI=1S/C27H54O3Si2/c1-11-31(12-2,13-3)28-23-19-27(20(7)8)25(29-32(14-4,15-5)16-6)24-21(9)17-18-22(24)26(23,10)30-27/h20-25H,11-19H2,1-10H3/t21-,22-,23-,24-,25-,26-,27+/m1/s1 |
| InChIKey | JTTJCLLIRRGMRJ-LHQKFFONSA-N |
| XLogP | 8.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.90 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|