C21H40O3Si — CID 46243248
(1S,2R,5S,6S,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-ol (PubChem CID 46243248) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is (1S,2R,5S,6S,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-ol.
| Compound Name | (1S,2R,5S,6S,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-ol |
|---|---|
| PubChem CID | 46243248 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (1S,2R,5S,6S,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-7-ol |
| SMILES | CC(C)[C@@]12C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@](C)(O1)[C@@H]1CC[C@H](C)[C@@H]1[C@@H]2O |
| InChI | InChI=1S/C21H40O3Si/c1-13(2)21-12-16(23-25(8,9)19(4,5)6)20(7,24-21)15-11-10-14(3)17(15)18(21)22/h13-18,22H,10-12H2,1-9H3/t14-,15+,16+,17-,18-,20-,21+/m0/s1 |
| InChIKey | KBRGFQKJKPMXRS-DLSMWHAWSA-N |
| XLogP | 4.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|