C24H32F3NO4SSi — CID 46900587
[(E)-[1-[3-[tert-butyl(dimethyl)silyl]oxy-4-propan-2-ylphenyl]-2,2,2-trifluoroethylidene]amino] 4-methylbenzenesulfonate (PubChem CID 46900587) has the molecular formula C24H32F3NO4SSi and a molecular weight of 515.67 g/mol. Its IUPAC name is [(E)-[1-[3-[tert-butyl(dimethyl)silyl]oxy-4-propan-2-ylphenyl]-2,2,2-trifluoroethylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [(E)-[1-[3-[tert-butyl(dimethyl)silyl]oxy-4-propan-2-ylphenyl]-2,2,2-trifluoroethylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 46900587 |
| Molecular Formula | C24H32F3NO4SSi |
| Molecular Weight | 515.67 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | [(E)-[1-[3-[tert-butyl(dimethyl)silyl]oxy-4-propan-2-ylphenyl]-2,2,2-trifluoroethylidene]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O/N=C(\c2ccc(C(C)C)c(O[Si](C)(C)C(C)(C)C)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H32F3NO4SSi/c1-16(2)20-14-11-18(15-21(20)31-34(7,8)23(4,5)6)22(24(25,26)27)28-32-33(29,30)19-12-9-17(3)10-13-19/h9-16H,1-8H3/b28-22+ |
| InChIKey | KOAPHNPPQUICHE-XAYXJRQQSA-N |
| XLogP | 7.17 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.67 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|