C15H29N3S — CID 46902190
(5S)-5-[(2S)-butan-2-yl]-1-[(1-ethylpiperidin-4-yl)methyl]imidazolidine-2-thione (PubChem CID 46902190) has the molecular formula C15H29N3S and a molecular weight of 283.48 g/mol. Its IUPAC name is (5S)-5-[(2S)-butan-2-yl]-1-[(1-ethylpiperidin-4-yl)methyl]imidazolidine-2-thione.
| Compound Name | (5S)-5-[(2S)-butan-2-yl]-1-[(1-ethylpiperidin-4-yl)methyl]imidazolidine-2-thione |
|---|---|
| PubChem CID | 46902190 |
| Molecular Formula | C15H29N3S |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | (5S)-5-[(2S)-butan-2-yl]-1-[(1-ethylpiperidin-4-yl)methyl]imidazolidine-2-thione |
| SMILES | CC[C@H](C)[C@H]1CNC(=S)N1CC1CCN(CC)CC1 |
| InChI | InChI=1S/C15H29N3S/c1-4-12(3)14-10-16-15(19)18(14)11-13-6-8-17(5-2)9-7-13/h12-14H,4-11H2,1-3H3,(H,16,19)/t12-,14+/m0/s1 |
| InChIKey | FGSIBOPHHIQYLQ-GXTWGEPZSA-N |
| XLogP | 2.32 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|