C27H30N4O9S — CID 46902279
[(2R,6R,7S)-6-hydroxy-4-(4-methylphenyl)sulfonyl-10,13-dioxo-1,4,9-triazatricyclo[7.4.0.02,6]tridec-11-en-7-yl] N-[(3,4-dimethoxyphenyl)methyl]carbamate (PubChem CID 46902279) has the molecular formula C27H30N4O9S and a molecular weight of 586.62 g/mol. Its IUPAC name is [(2R,6R,7S)-6-hydroxy-4-(4-methylphenyl)sulfonyl-10,13-dioxo-1,4,9-triazatricyclo[7.4.0.02,6]tridec-11-en-7-yl] N-[(3,4-dimethoxyphenyl)methyl]carbamate.
| Compound Name | [(2R,6R,7S)-6-hydroxy-4-(4-methylphenyl)sulfonyl-10,13-dioxo-1,4,9-triazatricyclo[7.4.0.02,6]tridec-11-en-7-yl] N-[(3,4-dimethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 46902279 |
| Molecular Formula | C27H30N4O9S |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | [(2R,6R,7S)-6-hydroxy-4-(4-methylphenyl)sulfonyl-10,13-dioxo-1,4,9-triazatricyclo[7.4.0.02,6]tridec-11-en-7-yl] N-[(3,4-dimethoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(CNC(=O)O[C@H]2Cn3c(=O)ccc(=O)n3[C@@H]3CN(S(=O)(=O)c4ccc(C)cc4)C[C@]23O)cc1OC |
| InChI | InChI=1S/C27H30N4O9S/c1-17-4-7-19(8-5-17)41(36,37)29-14-22-27(35,16-29)23(15-30-24(32)10-11-25(33)31(22)30)40-26(34)28-13-18-6-9-20(38-2)21(12-18)39-3/h4-12,22-23,35H,13-16H2,1-3H3,(H,28,34)/t22-,23+,27-/m1/s1 |
| InChIKey | SAEZRIOVEDHTPT-QSEAXJEQSA-N |
| XLogP | 0.62 |
| TPSA | 158.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |