C25H32N4O7S — CID 46902276
[(2R,6R,7S)-6-hydroxy-4-(4-methylphenyl)sulfonyl-10,13-dioxo-1,4,9-triazatricyclo[7.4.0.02,6]tridec-11-en-7-yl] N-(cyclohexylmethyl)carbamate (PubChem CID 46902276) has the molecular formula C25H32N4O7S and a molecular weight of 532.62 g/mol. Its IUPAC name is [(2R,6R,7S)-6-hydroxy-4-(4-methylphenyl)sulfonyl-10,13-dioxo-1,4,9-triazatricyclo[7.4.0.02,6]tridec-11-en-7-yl] N-(cyclohexylmethyl)carbamate.
| Compound Name | [(2R,6R,7S)-6-hydroxy-4-(4-methylphenyl)sulfonyl-10,13-dioxo-1,4,9-triazatricyclo[7.4.0.02,6]tridec-11-en-7-yl] N-(cyclohexylmethyl)carbamate |
|---|---|
| PubChem CID | 46902276 |
| Molecular Formula | C25H32N4O7S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | [(2R,6R,7S)-6-hydroxy-4-(4-methylphenyl)sulfonyl-10,13-dioxo-1,4,9-triazatricyclo[7.4.0.02,6]tridec-11-en-7-yl] N-(cyclohexylmethyl)carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3n4c(=O)ccc(=O)n4C[C@H](OC(=O)NCC4CCCCC4)[C@@]3(O)C2)cc1 |
| InChI | InChI=1S/C25H32N4O7S/c1-17-7-9-19(10-8-17)37(34,35)27-14-20-25(33,16-27)21(15-28-22(30)11-12-23(31)29(20)28)36-24(32)26-13-18-5-3-2-4-6-18/h7-12,18,20-21,33H,2-6,13-16H2,1H3,(H,26,32)/t20-,21+,25-/m1/s1 |
| InChIKey | WECFHXFSFWTSKQ-TYBLODHISA-N |
| XLogP | 0.98 |
| TPSA | 139.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |