C27H38N2O9S — CID 46902309
dimethyl (3aS,5R,6S,7aR)-3a-(cyclohexylmethylcarbamoyloxy)-7a-hydroxy-2-(4-methylphenyl)sulfonyl-1,3,4,5,6,7-hexahydroisoindole-5,6-dicarboxylate (PubChem CID 46902309) has the molecular formula C27H38N2O9S and a molecular weight of 566.67 g/mol. Its IUPAC name is dimethyl (3aS,5R,6S,7aR)-3a-(cyclohexylmethylcarbamoyloxy)-7a-hydroxy-2-(4-methylphenyl)sulfonyl-1,3,4,5,6,7-hexahydroisoindole-5,6-dicarboxylate.
| Compound Name | dimethyl (3aS,5R,6S,7aR)-3a-(cyclohexylmethylcarbamoyloxy)-7a-hydroxy-2-(4-methylphenyl)sulfonyl-1,3,4,5,6,7-hexahydroisoindole-5,6-dicarboxylate |
|---|---|
| PubChem CID | 46902309 |
| Molecular Formula | C27H38N2O9S |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | dimethyl (3aS,5R,6S,7aR)-3a-(cyclohexylmethylcarbamoyloxy)-7a-hydroxy-2-(4-methylphenyl)sulfonyl-1,3,4,5,6,7-hexahydroisoindole-5,6-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@]2(O)CN(S(=O)(=O)c3ccc(C)cc3)C[C@@]2(OC(=O)NCC2CCCCC2)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C27H38N2O9S/c1-18-9-11-20(12-10-18)39(34,35)29-16-26(33)13-21(23(30)36-2)22(24(31)37-3)14-27(26,17-29)38-25(32)28-15-19-7-5-4-6-8-19/h9-12,19,21-22,33H,4-8,13-17H2,1-3H3,(H,28,32)/t21-,22+,26+,27-/m0/s1 |
| InChIKey | XDLDYQDPLFHJJS-BKNUMKMGSA-N |
| XLogP | 2.15 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|