C12H18ClN3O3S — CID 4690347
N-[2-(2-chloroethyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-methylsulfanylacetamide (PubChem CID 4690347) has the molecular formula C12H18ClN3O3S and a molecular weight of 319.81 g/mol. Its IUPAC name is N-[2-(2-chloroethyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-methylsulfanylacetamide.
| Compound Name | N-[2-(2-chloroethyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 4690347 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-[2-(2-chloroethyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)NC1CCN2C(=O)N(CCCl)C(=O)C2C1 |
| InChI | InChI=1S/C12H18ClN3O3S/c1-20-7-10(17)14-8-2-4-15-9(6-8)11(18)16(5-3-13)12(15)19/h8-9H,2-7H2,1H3,(H,14,17) |
| InChIKey | FNLOZRLFDAJTBH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|