C13H21ClN4O3 — CID 3785445
1-[2-(2-chloroethyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-3-propan-2-ylurea (PubChem CID 3785445) has the molecular formula C13H21ClN4O3 and a molecular weight of 316.79 g/mol. Its IUPAC name is 1-[2-(2-chloroethyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-3-propan-2-ylurea.
| Compound Name | 1-[2-(2-chloroethyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 3785445 |
| Molecular Formula | C13H21ClN4O3 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1-[2-(2-chloroethyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NC1CCN2C(=O)N(CCCl)C(=O)C2C1 |
| InChI | InChI=1S/C13H21ClN4O3/c1-8(2)15-12(20)16-9-3-5-17-10(7-9)11(19)18(6-4-14)13(17)21/h8-10H,3-7H2,1-2H3,(H2,15,16,20) |
| InChIKey | AXXHYKFTPKYLOF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|