C9H17N3O2 — CID 95969340
1-[(3R)-1-methyl-5-oxopyrrolidin-3-yl]-3-propan-2-ylurea (PubChem CID 95969340) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-[(3R)-1-methyl-5-oxopyrrolidin-3-yl]-3-propan-2-ylurea.
| Compound Name | 1-[(3R)-1-methyl-5-oxopyrrolidin-3-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 95969340 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 1-[(3R)-1-methyl-5-oxopyrrolidin-3-yl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N[C@@H]1CC(=O)N(C)C1 |
| InChI | InChI=1S/C9H17N3O2/c1-6(2)10-9(14)11-7-4-8(13)12(3)5-7/h6-7H,4-5H2,1-3H3,(H2,10,11,14)/t7-/m1/s1 |
| InChIKey | OSWPAWIQDDWILG-SSDOTTSWSA-N |
| XLogP | -0.08 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |