C11H21N3O2 — CID 56794755
1-(1-methyl-5-oxopyrrolidin-3-yl)-3-pentylurea (PubChem CID 56794755) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 1-(1-methyl-5-oxopyrrolidin-3-yl)-3-pentylurea.
| Compound Name | 1-(1-methyl-5-oxopyrrolidin-3-yl)-3-pentylurea |
|---|---|
| PubChem CID | 56794755 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 1-(1-methyl-5-oxopyrrolidin-3-yl)-3-pentylurea |
| SMILES | CCCCCNC(=O)NC1CC(=O)N(C)C1 |
| InChI | InChI=1S/C11H21N3O2/c1-3-4-5-6-12-11(16)13-9-7-10(15)14(2)8-9/h9H,3-8H2,1-2H3,(H2,12,13,16) |
| InChIKey | PBUJHZRGHGWIOP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|