C11H19N3O3 — CID 138049629
1-[(3-methyloxetan-3-yl)methyl]-3-[(3S)-1-methyl-5-oxopyrrolidin-3-yl]urea (PubChem CID 138049629) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-[(3-methyloxetan-3-yl)methyl]-3-[(3S)-1-methyl-5-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-[(3-methyloxetan-3-yl)methyl]-3-[(3S)-1-methyl-5-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 138049629 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-[(3-methyloxetan-3-yl)methyl]-3-[(3S)-1-methyl-5-oxopyrrolidin-3-yl]urea |
| SMILES | CN1C[C@@H](NC(=O)NCC2(C)COC2)CC1=O |
| InChI | InChI=1S/C11H19N3O3/c1-11(6-17-7-11)5-12-10(16)13-8-3-9(15)14(2)4-8/h8H,3-7H2,1-2H3,(H2,12,13,16)/t8-/m0/s1 |
| InChIKey | WMLLWFRLRFULKV-QMMMGPOBSA-N |
| XLogP | -0.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |