C20H24ClF3N6O3 — CID 3518594
N-[2-(2-chloroethyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidine-4-carboxamide (PubChem CID 3518594) has the molecular formula C20H24ClF3N6O3 and a molecular weight of 488.90 g/mol. Its IUPAC name is N-[2-(2-chloroethyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[2-(2-chloroethyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3518594 |
| Molecular Formula | C20H24ClF3N6O3 |
| Molecular Weight | 488.90 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | N-[2-(2-chloroethyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidine-4-carboxamide |
| SMILES | O=C(NC1CCN2C(=O)N(CCCl)C(=O)C2C1)C1CCN(c2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C20H24ClF3N6O3/c21-5-10-30-17(32)14-11-13(4-9-29(14)19(30)33)26-16(31)12-2-7-28(8-3-12)18-25-6-1-15(27-18)20(22,23)24/h1,6,12-14H,2-5,7-11H2,(H,26,31) |
| InChIKey | DWDRQBAOTRLVPX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.90 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|