C31H34N2O7S — CID 46903530
N-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-[(E)-2-phenylethenyl]-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-1,3-benzodioxole-5-carboxamide (PubChem CID 46903530) has the molecular formula C31H34N2O7S and a molecular weight of 578.69 g/mol. Its IUPAC name is N-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-[(E)-2-phenylethenyl]-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-[(E)-2-phenylethenyl]-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 46903530 |
| Molecular Formula | C31H34N2O7S |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | N-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-[(E)-2-phenylethenyl]-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-1,3-benzodioxole-5-carboxamide |
| SMILES | C[C@H](CO)N1C[C@H](C)[C@@H](CN(C)C(=O)c2ccc3c(c2)OCO3)Oc2cc(/C=C/c3ccccc3)ccc2S1(=O)=O |
| InChI | InChI=1S/C31H34N2O7S/c1-21-17-33(22(2)19-34)41(36,37)30-14-11-24(10-9-23-7-5-4-6-8-23)15-28(30)40-29(21)18-32(3)31(35)25-12-13-26-27(16-25)39-20-38-26/h4-16,21-22,29,34H,17-20H2,1-3H3/b10-9+/t21-,22+,29+/m0/s1 |
| InChIKey | USONUACEONEJBL-MGUJSOGQSA-N |
| XLogP | 4.13 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|