C29H39N3O6S — CID 54618775
N-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-[(E)-2-phenylethenyl]-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-2-morpholin-4-ylacetamide (PubChem CID 54618775) has the molecular formula C29H39N3O6S and a molecular weight of 557.71 g/mol. Its IUPAC name is N-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-[(E)-2-phenylethenyl]-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-2-morpholin-4-ylacetamide.
| Compound Name | N-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-[(E)-2-phenylethenyl]-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 54618775 |
| Molecular Formula | C29H39N3O6S |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | N-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-[(E)-2-phenylethenyl]-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-2-morpholin-4-ylacetamide |
| SMILES | C[C@H](CO)N1C[C@H](C)[C@@H](CN(C)C(=O)CN2CCOCC2)Oc2cc(/C=C/c3ccccc3)ccc2S1(=O)=O |
| InChI | InChI=1S/C29H39N3O6S/c1-22-18-32(23(2)21-33)39(35,36)28-12-11-25(10-9-24-7-5-4-6-8-24)17-26(28)38-27(22)19-30(3)29(34)20-31-13-15-37-16-14-31/h4-12,17,22-23,27,33H,13-16,18-21H2,1-3H3/b10-9+/t22-,23+,27+/m0/s1 |
| InChIKey | BANHLTBDTXCVOB-FXTDCYOPSA-N |
| XLogP | 2.42 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|