C29H36FN3O6S — CID 46903419
N-[[(4R,5S)-8-[2-(3-fluorophenyl)ethynyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-2-morpholin-4-ylacetamide (PubChem CID 46903419) has the molecular formula C29H36FN3O6S and a molecular weight of 573.69 g/mol. Its IUPAC name is N-[[(4R,5S)-8-[2-(3-fluorophenyl)ethynyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-2-morpholin-4-ylacetamide.
| Compound Name | N-[[(4R,5S)-8-[2-(3-fluorophenyl)ethynyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 46903419 |
| Molecular Formula | C29H36FN3O6S |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | N-[[(4R,5S)-8-[2-(3-fluorophenyl)ethynyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-2-morpholin-4-ylacetamide |
| SMILES | C[C@@H]1CN([C@H](C)CO)S(=O)(=O)c2ccc(C#Cc3cccc(F)c3)cc2O[C@@H]1CN(C)C(=O)CN1CCOCC1 |
| InChI | InChI=1S/C29H36FN3O6S/c1-21-17-33(22(2)20-34)40(36,37)28-10-9-24(8-7-23-5-4-6-25(30)15-23)16-26(28)39-27(21)18-31(3)29(35)19-32-11-13-38-14-12-32/h4-6,9-10,15-16,21-22,27,34H,11-14,17-20H2,1-3H3/t21-,22-,27-/m1/s1 |
| InChIKey | KTODVLGNKLCUKS-VHFRWLAGSA-N |
| XLogP | 1.78 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|